C34H16N4S4 — CID 71519460
2-[9,10-bis(1,3-dithiol-2-ylidene)anthracen-2-yl]-3-phenylbuta-1,3-diene-1,1,4,4-tetracarbonitrile (PubChem CID 71519460) has the molecular formula C34H16N4S4 and a molecular weight of 608.80 g/mol. Its IUPAC name is 2-[9,10-bis(1,3-dithiol-2-ylidene)anthracen-2-yl]-3-phenylbuta-1,3-diene-1,1,4,4-tetracarbonitrile.
| Compound Name | 2-[9,10-bis(1,3-dithiol-2-ylidene)anthracen-2-yl]-3-phenylbuta-1,3-diene-1,1,4,4-tetracarbonitrile |
|---|---|
| PubChem CID | 71519460 |
| Molecular Formula | C34H16N4S4 |
| Molecular Weight | 608.80 g/mol |
| Exact Mass | 608.03 |
| IUPAC Name | 2-[9,10-bis(1,3-dithiol-2-ylidene)anthracen-2-yl]-3-phenylbuta-1,3-diene-1,1,4,4-tetracarbonitrile |
| SMILES | N#CC(C#N)=C(C(=C(C#N)C#N)c1ccc2c(=C3SC=CS3)c3ccccc3c(=C3SC=CS3)c2c1)c1ccccc1 |
| InChI | InChI=1S/C34H16N4S4/c35-17-23(18-36)29(21-6-2-1-3-7-21)30(24(19-37)20-38)22-10-11-27-28(16-22)32(34-41-14-15-42-34)26-9-5-4-8-25(26)31(27)33-39-12-13-40-33/h1-16H |
| InChIKey | CNDBMCXQCVTXLU-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.80 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|