About dipotassium;hydride;2-(sulfanylmethylidene)propanedinitrile
dipotassium;hydride;2-(sulfanylmethylidene)propanedinitrile (PubChem CID 173458500) has the molecular formula C4H4K2N2S
and a molecular weight of 190.35 g/mol. Its IUPAC name is dipotassium;hydride;2-(sulfanylmethylidene)propanedinitrile.
Molecular Properties
| Compound Name | dipotassium;hydride;2-(sulfanylmethylidene)propanedinitrile |
| PubChem CID | 173458500 |
| Molecular Formula | C4H4K2N2S |
| Molecular Weight | 190.35 g/mol |
| Exact Mass | 189.94 |
| IUPAC Name | dipotassium;hydride;2-(sulfanylmethylidene)propanedinitrile |
| SMILES | N#CC(C#N)=CS.[H-].[H-].[K+].[K+] |
| InChI | InChI=1S/C4H2N2S.2K.2H/c5-1-4(2-6)3-7;;;;/h3,7H;;;;/q;2*+1;2*-1 |
| InChIKey | KJXNSNDYCLWWSB-UHFFFAOYSA-N |
| XLogP | -4.92 |
| TPSA | 47.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.35 |
| LogP ≤ 5 | -4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze dipotassium;hydride;2-(sulfanylmethylidene)propanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;hydride;2-(sulfanylmethylidene)propanedinitrile?
The IUPAC name of dipotassium;hydride;2-(sulfanylmethylidene)propanedinitrile (CID 173458500) is dipotassium;hydride;2-(sulfanylmethylidene)propanedinitrile.
What is the SMILES notation for dipotassium;hydride;2-(sulfanylmethylidene)propanedinitrile?
The canonical SMILES for dipotassium;hydride;2-(sulfanylmethylidene)propanedinitrile is N#CC(C#N)=CS.[H-].[H-].[K+].[K+].
What is the InChIKey of dipotassium;hydride;2-(sulfanylmethylidene)propanedinitrile?
The InChIKey is KJXNSNDYCLWWSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2N2S.2K.2H/c5-1-4(2-6)3-7;;;;/h3,7H;;;;/q;2*+1;2*-1.
What are the key properties of dipotassium;hydride;2-(sulfanylmethylidene)propanedinitrile?
dipotassium;hydride;2-(sulfanylmethylidene)propanedinitrile has a molecular weight of 190.35 g/mol, XLogP of -4.92, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;hydride;2-(sulfanylmethylidene)propanedinitrile is sourced from PubChem (CID 173458500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).