About (2Z)-3,4-dioxo-2-(sulfanylmethylidene)butanenitrile
(2Z)-3,4-dioxo-2-(sulfanylmethylidene)butanenitrile (PubChem CID 59081856) has the molecular formula C5H3NO2S
and a molecular weight of 141.15 g/mol. Its IUPAC name is (2Z)-3,4-dioxo-2-(sulfanylmethylidene)butanenitrile.
Molecular Properties
| Compound Name | (2Z)-3,4-dioxo-2-(sulfanylmethylidene)butanenitrile |
| PubChem CID | 59081856 |
| Molecular Formula | C5H3NO2S |
| Molecular Weight | 141.15 g/mol |
| Exact Mass | 140.99 |
| IUPAC Name | (2Z)-3,4-dioxo-2-(sulfanylmethylidene)butanenitrile |
| SMILES | N#C/C(=C/S)C(=O)C=O |
| InChI | InChI=1S/C5H3NO2S/c6-1-4(3-9)5(8)2-7/h2-3,9H/b4-3- |
| InChIKey | LSRHXMHFXUCCBQ-ARJAWSKDSA-N |
| XLogP | 0.09 |
| TPSA | 57.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.15 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-3,4-dioxo-2-(sulfanylmethylidene)butanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-3,4-dioxo-2-(sulfanylmethylidene)butanenitrile?
The IUPAC name of (2Z)-3,4-dioxo-2-(sulfanylmethylidene)butanenitrile (CID 59081856) is (2Z)-3,4-dioxo-2-(sulfanylmethylidene)butanenitrile.
What is the SMILES notation for (2Z)-3,4-dioxo-2-(sulfanylmethylidene)butanenitrile?
The canonical SMILES for (2Z)-3,4-dioxo-2-(sulfanylmethylidene)butanenitrile is N#C/C(=C/S)C(=O)C=O.
What is the InChIKey of (2Z)-3,4-dioxo-2-(sulfanylmethylidene)butanenitrile?
The InChIKey is LSRHXMHFXUCCBQ-ARJAWSKDSA-N. The full InChI is InChI=1S/C5H3NO2S/c6-1-4(3-9)5(8)2-7/h2-3,9H/b4-3-.
What are the key properties of (2Z)-3,4-dioxo-2-(sulfanylmethylidene)butanenitrile?
(2Z)-3,4-dioxo-2-(sulfanylmethylidene)butanenitrile has a molecular weight of 141.15 g/mol, XLogP of 0.09, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-3,4-dioxo-2-(sulfanylmethylidene)butanenitrile is sourced from PubChem (CID 59081856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).