About 3-oxopropanoyl cyanide
3-oxopropanoyl cyanide (PubChem CID 57085154) has the molecular formula C4H3NO2
and a molecular weight of 97.07 g/mol. Its IUPAC name is 3-oxopropanoyl cyanide.
Molecular Properties
| Compound Name | 3-oxopropanoyl cyanide |
| PubChem CID | 57085154 |
| Molecular Formula | C4H3NO2 |
| Molecular Weight | 97.07 g/mol |
| Exact Mass | 97.02 |
| IUPAC Name | 3-oxopropanoyl cyanide |
| SMILES | N#CC(=O)CC=O |
| InChI | InChI=1S/C4H3NO2/c5-3-4(7)1-2-6/h2H,1H2 |
| InChIKey | IMUGDXGTIOVJBS-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 97.07 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-oxopropanoyl cyanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxopropanoyl cyanide?
The IUPAC name of 3-oxopropanoyl cyanide (CID 57085154) is 3-oxopropanoyl cyanide.
What is the SMILES notation for 3-oxopropanoyl cyanide?
The canonical SMILES for 3-oxopropanoyl cyanide is N#CC(=O)CC=O.
What is the InChIKey of 3-oxopropanoyl cyanide?
The InChIKey is IMUGDXGTIOVJBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3NO2/c5-3-4(7)1-2-6/h2H,1H2.
What are the key properties of 3-oxopropanoyl cyanide?
3-oxopropanoyl cyanide has a molecular weight of 97.07 g/mol, XLogP of -0.33, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxopropanoyl cyanide is sourced from PubChem (CID 57085154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).