About λ2-plumbane;3-oxobutanal
λ2-plumbane;3-oxobutanal (PubChem CID 173391243) has the molecular formula C4H8O2Pb
and a molecular weight of 295.31 g/mol. Its IUPAC name is λ2-plumbane;3-oxobutanal.
Molecular Properties
| Compound Name | λ2-plumbane;3-oxobutanal |
| PubChem CID | 173391243 |
| Molecular Formula | C4H8O2Pb |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | λ2-plumbane;3-oxobutanal |
| SMILES | CC(=O)CC=O.[PbH2] |
| InChI | InChI=1S/C4H6O2.Pb.2H/c1-4(6)2-3-5;;;/h3H,2H2,1H3;;; |
| InChIKey | OFJCBUNAFZYZKW-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze λ2-plumbane;3-oxobutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of λ2-plumbane;3-oxobutanal?
The IUPAC name of λ2-plumbane;3-oxobutanal (CID 173391243) is λ2-plumbane;3-oxobutanal.
What is the SMILES notation for λ2-plumbane;3-oxobutanal?
The canonical SMILES for λ2-plumbane;3-oxobutanal is CC(=O)CC=O.[PbH2].
What is the InChIKey of λ2-plumbane;3-oxobutanal?
The InChIKey is OFJCBUNAFZYZKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O2.Pb.2H/c1-4(6)2-3-5;;;/h3H,2H2,1H3;;;.
What are the key properties of λ2-plumbane;3-oxobutanal?
λ2-plumbane;3-oxobutanal has a molecular weight of 295.31 g/mol, XLogP of -0.75, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for λ2-plumbane;3-oxobutanal is sourced from PubChem (CID 173391243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).