About 3,4-dioxohexanedial
3,4-dioxohexanedial (PubChem CID 123634764) has the molecular formula C6H6O4
and a molecular weight of 142.11 g/mol. Its IUPAC name is 3,4-dioxohexanedial.
Molecular Properties
| Compound Name | 3,4-dioxohexanedial |
| PubChem CID | 123634764 |
| Molecular Formula | C6H6O4 |
| Molecular Weight | 142.11 g/mol |
| Exact Mass | 142.03 |
| IUPAC Name | 3,4-dioxohexanedial |
| SMILES | O=CCC(=O)C(=O)CC=O |
| InChI | InChI=1S/C6H6O4/c7-3-1-5(9)6(10)2-4-8/h3-4H,1-2H2 |
| InChIKey | JHVNJBQABGTRPH-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.11 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dioxohexanedial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dioxohexanedial?
The IUPAC name of 3,4-dioxohexanedial (CID 123634764) is 3,4-dioxohexanedial.
What is the SMILES notation for 3,4-dioxohexanedial?
The canonical SMILES for 3,4-dioxohexanedial is O=CCC(=O)C(=O)CC=O.
What is the InChIKey of 3,4-dioxohexanedial?
The InChIKey is JHVNJBQABGTRPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O4/c7-3-1-5(9)6(10)2-4-8/h3-4H,1-2H2.
What are the key properties of 3,4-dioxohexanedial?
3,4-dioxohexanedial has a molecular weight of 142.11 g/mol, XLogP of -0.70, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dioxohexanedial is sourced from PubChem (CID 123634764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).