C11H10ClN5 — CID 163335714
3-chloropenta-1,3-diene-1,1,5,5-tetracarbonitrile;dimethylazanium (PubChem CID 163335714) has the molecular formula C11H10ClN5 and a molecular weight of 247.69 g/mol. Its IUPAC name is 3-chloropenta-1,3-diene-1,1,5,5-tetracarbonitrile;dimethylazanium.
| Compound Name | 3-chloropenta-1,3-diene-1,1,5,5-tetracarbonitrile;dimethylazanium |
|---|---|
| PubChem CID | 163335714 |
| Molecular Formula | C11H10ClN5 |
| Molecular Weight | 247.69 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 3-chloropenta-1,3-diene-1,1,5,5-tetracarbonitrile;dimethylazanium |
| SMILES | C[NH2+]C.N#CC(C#N)=C/C(Cl)=[C-]/C(C#N)C#N |
| InChI | InChI=1S/C9H2ClN4.C2H7N/c10-9(1-7(3-11)4-12)2-8(5-13)6-14;1-3-2/h1,8H;3H,1-2H3/q-1;/p+1 |
| InChIKey | CJVGHUXHUKHELK-UHFFFAOYSA-O |
| XLogP | 0.36 |
| TPSA | 111.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.69 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|