About 2-cyanopropanimidoyl cyanide
2-cyanopropanimidoyl cyanide (PubChem CID 91120933) has the molecular formula C5H5N3
and a molecular weight of 107.12 g/mol. Its IUPAC name is 2-cyanopropanimidoyl cyanide.
Molecular Properties
| Compound Name | 2-cyanopropanimidoyl cyanide |
| PubChem CID | 91120933 |
| Molecular Formula | C5H5N3 |
| Molecular Weight | 107.12 g/mol |
| Exact Mass | 107.05 |
| IUPAC Name | 2-cyanopropanimidoyl cyanide |
| SMILES | [H]/N=C(\C#N)C(C)C#N |
| InChI | InChI=1S/C5H5N3/c1-4(2-6)5(8)3-7/h4,8H,1H3/b8-5+ |
| InChIKey | YRVRTPUCCKMCSC-VMPITWQZSA-N |
| XLogP | 0.69 |
| TPSA | 71.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 107.12 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-cyanopropanimidoyl cyanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyanopropanimidoyl cyanide?
The IUPAC name of 2-cyanopropanimidoyl cyanide (CID 91120933) is 2-cyanopropanimidoyl cyanide.
What is the SMILES notation for 2-cyanopropanimidoyl cyanide?
The canonical SMILES for 2-cyanopropanimidoyl cyanide is [H]/N=C(\C#N)C(C)C#N.
What is the InChIKey of 2-cyanopropanimidoyl cyanide?
The InChIKey is YRVRTPUCCKMCSC-VMPITWQZSA-N. The full InChI is InChI=1S/C5H5N3/c1-4(2-6)5(8)3-7/h4,8H,1H3/b8-5+.
What are the key properties of 2-cyanopropanimidoyl cyanide?
2-cyanopropanimidoyl cyanide has a molecular weight of 107.12 g/mol, XLogP of 0.69, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyanopropanimidoyl cyanide is sourced from PubChem (CID 91120933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).