C14H12ClN5 — CID 13497281
3-[chloro(diethylamino)methylidene]penta-1,4-diene-1,1,5,5-tetracarbonitrile (PubChem CID 13497281) has the molecular formula C14H12ClN5 and a molecular weight of 285.74 g/mol. Its IUPAC name is 3-[chloro(diethylamino)methylidene]penta-1,4-diene-1,1,5,5-tetracarbonitrile.
| Compound Name | 3-[chloro(diethylamino)methylidene]penta-1,4-diene-1,1,5,5-tetracarbonitrile |
|---|---|
| PubChem CID | 13497281 |
| Molecular Formula | C14H12ClN5 |
| Molecular Weight | 285.74 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 3-[chloro(diethylamino)methylidene]penta-1,4-diene-1,1,5,5-tetracarbonitrile |
| SMILES | CCN(CC)C(Cl)=C(C=C(C#N)C#N)C=C(C#N)C#N |
| InChI | InChI=1S/C14H12ClN5/c1-3-20(4-2)14(15)13(5-11(7-16)8-17)6-12(9-18)10-19/h5-6H,3-4H2,1-2H3 |
| InChIKey | VKOMKVXLHXNUHZ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 98.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.74 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|