C28H19N5 — CID 141246400
2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]buta-1,3-diene-1,1,4,4-tetracarbonitrile (PubChem CID 141246400) has the molecular formula C28H19N5 and a molecular weight of 425.50 g/mol. Its IUPAC name is 2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]buta-1,3-diene-1,1,4,4-tetracarbonitrile.
| Compound Name | 2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]buta-1,3-diene-1,1,4,4-tetracarbonitrile |
|---|---|
| PubChem CID | 141246400 |
| Molecular Formula | C28H19N5 |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]buta-1,3-diene-1,1,4,4-tetracarbonitrile |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2ccc(C(C=C(C#N)C#N)=C(C#N)C#N)cc2)cc1 |
| InChI | InChI=1S/C28H19N5/c1-20-3-9-25(10-4-20)33(26-11-5-21(2)6-12-26)27-13-7-23(8-14-27)28(24(18-31)19-32)15-22(16-29)17-30/h3-15H,1-2H3 |
| InChIKey | LFZOZWPFULPEPF-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 98.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|