C64H38N10 — CID 139091632
2-[2-[4-(dicyanomethylidene)cyclohexa-2,5-dien-1-ylidene]-2-[4-(N-phenylanilino)phenyl]ethylidene]propanedinitrile (PubChem CID 139091632) has the molecular formula C64H38N10 and a molecular weight of 947.08 g/mol. Its IUPAC name is 2-[2-[4-(dicyanomethylidene)cyclohexa-2,5-dien-1-ylidene]-2-[4-(N-phenylanilino)phenyl]ethylidene]propanedinitrile.
| Compound Name | 2-[2-[4-(dicyanomethylidene)cyclohexa-2,5-dien-1-ylidene]-2-[4-(N-phenylanilino)phenyl]ethylidene]propanedinitrile |
|---|---|
| PubChem CID | 139091632 |
| Molecular Formula | C64H38N10 |
| Molecular Weight | 947.08 g/mol |
| Exact Mass | 946.33 |
| IUPAC Name | 2-[2-[4-(dicyanomethylidene)cyclohexa-2,5-dien-1-ylidene]-2-[4-(N-phenylanilino)phenyl]ethylidene]propanedinitrile |
| SMILES | N#CC(C#N)=CC(c1ccc(N(c2ccccc2)c2ccccc2)cc1)=c1ccc(=C(C#N)C#N)cc1.N#CC(C#N)=CC(c1ccc(N(c2ccccc2)c2ccccc2)cc1)=c1ccc(=C(C#N)C#N)cc1 |
| InChI | InChI=1S/2C32H19N5/c2*33-20-24(21-34)19-32(26-13-11-25(12-14-26)28(22-35)23-36)27-15-17-31(18-16-27)37(29-7-3-1-4-8-29)30-9-5-2-6-10-30/h2*1-19H |
| InChIKey | PUXOXQJZOVEBOA-UHFFFAOYSA-N |
| XLogP | 11.05 |
| TPSA | 196.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 947.08 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|