C11H5N3O — CID 11465516
2-[4-[cyano(hydroxy)methylidene]cyclohexa-2,5-dien-1-ylidene]propanedinitrile (PubChem CID 11465516) has the molecular formula C11H5N3O and a molecular weight of 195.18 g/mol. Its IUPAC name is 2-[4-[cyano(hydroxy)methylidene]cyclohexa-2,5-dien-1-ylidene]propanedinitrile.
| Compound Name | 2-[4-[cyano(hydroxy)methylidene]cyclohexa-2,5-dien-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 11465516 |
| Molecular Formula | C11H5N3O |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.04 |
| IUPAC Name | 2-[4-[cyano(hydroxy)methylidene]cyclohexa-2,5-dien-1-ylidene]propanedinitrile |
| SMILES | N#CC(O)=c1ccc(=C(C#N)C#N)cc1 |
| InChI | InChI=1S/C11H5N3O/c12-5-10(6-13)8-1-3-9(4-2-8)11(15)7-14/h1-4,15H |
| InChIKey | BXAZXNHPSXZSLS-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 91.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|