C28H17N3S2 — CID 171922430
2-[[5-[4-(N-phenylanilino)phenyl]thieno[3,2-b]thiophen-2-yl]methylidene]propanedinitrile (PubChem CID 171922430) has the molecular formula C28H17N3S2 and a molecular weight of 459.60 g/mol. Its IUPAC name is 2-[[5-[4-(N-phenylanilino)phenyl]thieno[3,2-b]thiophen-2-yl]methylidene]propanedinitrile.
| Compound Name | 2-[[5-[4-(N-phenylanilino)phenyl]thieno[3,2-b]thiophen-2-yl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 171922430 |
| Molecular Formula | C28H17N3S2 |
| Molecular Weight | 459.60 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | 2-[[5-[4-(N-phenylanilino)phenyl]thieno[3,2-b]thiophen-2-yl]methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=Cc1cc2sc(-c3ccc(N(c4ccccc4)c4ccccc4)cc3)cc2s1 |
| InChI | InChI=1S/C28H17N3S2/c29-18-20(19-30)15-25-16-27-28(32-25)17-26(33-27)21-11-13-24(14-12-21)31(22-7-3-1-4-8-22)23-9-5-2-6-10-23/h1-17H |
| InChIKey | COSLURHONHCPIN-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.60 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|