C35H23N3S3 — CID 147205390
2-[[5-[8,8-dimethyl-5-(N-phenylanilino)-11,15-dithiatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2(7),3,5,10(14),12-hexaen-12-yl]thiophen-2-yl]methylidene]propanedinitrile (PubChem CID 147205390) has the molecular formula C35H23N3S3 and a molecular weight of 581.79 g/mol. Its IUPAC name is 2-[[5-[8,8-dimethyl-5-(N-phenylanilino)-11,15-dithiatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2(7),3,5,10(14),12-hexaen-12-yl]thiophen-2-yl]methylidene]propanedinitrile.
| Compound Name | 2-[[5-[8,8-dimethyl-5-(N-phenylanilino)-11,15-dithiatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2(7),3,5,10(14),12-hexaen-12-yl]thiophen-2-yl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 147205390 |
| Molecular Formula | C35H23N3S3 |
| Molecular Weight | 581.79 g/mol |
| Exact Mass | 581.11 |
| IUPAC Name | 2-[[5-[8,8-dimethyl-5-(N-phenylanilino)-11,15-dithiatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2(7),3,5,10(14),12-hexaen-12-yl]thiophen-2-yl]methylidene]propanedinitrile |
| SMILES | CC1(C)c2cc(N(c3ccccc3)c3ccccc3)ccc2-c2sc3cc(-c4ccc(C=C(C#N)C#N)s4)sc3c21 |
| InChI | InChI=1S/C35H23N3S3/c1-35(2)28-18-25(38(23-9-5-3-6-10-23)24-11-7-4-8-12-24)13-15-27(28)33-32(35)34-31(41-33)19-30(40-34)29-16-14-26(39-29)17-22(20-36)21-37/h3-19H,1-2H3 |
| InChIKey | CEDXEUXDWITKLA-UHFFFAOYSA-N |
| XLogP | 10.90 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.79 |
| LogP ≤ 5 | 10.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|