C18H40N4 — CID 101365533
1-N,1-N,1-N',1-N',2-N,2-N,2-N',2-N'-octaethylethene-1,1,2,2-tetramine (PubChem CID 101365533) has the molecular formula C18H40N4 and a molecular weight of 312.55 g/mol. Its IUPAC name is 1-N,1-N,1-N',1-N',2-N,2-N,2-N',2-N'-octaethylethene-1,1,2,2-tetramine.
| Compound Name | 1-N,1-N,1-N',1-N',2-N,2-N,2-N',2-N'-octaethylethene-1,1,2,2-tetramine |
|---|---|
| PubChem CID | 101365533 |
| Molecular Formula | C18H40N4 |
| Molecular Weight | 312.55 g/mol |
| Exact Mass | 312.33 |
| IUPAC Name | 1-N,1-N,1-N',1-N',2-N,2-N,2-N',2-N'-octaethylethene-1,1,2,2-tetramine |
| SMILES | CCN(CC)C(=C(N(CC)CC)N(CC)CC)N(CC)CC |
| InChI | InChI=1S/C18H40N4/c1-9-19(10-2)17(20(11-3)12-4)18(21(13-5)14-6)22(15-7)16-8/h9-16H2,1-8H3 |
| InChIKey | JBJVSNBRUTZYLQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.55 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |