About sodium;diethylcarbamic acid;hydride
sodium;diethylcarbamic acid;hydride (PubChem CID 174452447) has the molecular formula C5H12NNaO2
and a molecular weight of 141.15 g/mol. Its IUPAC name is sodium;diethylcarbamic acid;hydride.
Molecular Properties
| Compound Name | sodium;diethylcarbamic acid;hydride |
| PubChem CID | 174452447 |
| Molecular Formula | C5H12NNaO2 |
| Molecular Weight | 141.15 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | sodium;diethylcarbamic acid;hydride |
| SMILES | CCN(CC)C(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C5H11NO2.Na.H/c1-3-6(4-2)5(7)8;;/h3-4H2,1-2H3,(H,7,8);;/q;+1;-1 |
| InChIKey | GBLHKBZKSKECRL-UHFFFAOYSA-N |
| XLogP | -1.88 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.15 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze sodium;diethylcarbamic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;diethylcarbamic acid;hydride?
The IUPAC name of sodium;diethylcarbamic acid;hydride (CID 174452447) is sodium;diethylcarbamic acid;hydride.
What is the SMILES notation for sodium;diethylcarbamic acid;hydride?
The canonical SMILES for sodium;diethylcarbamic acid;hydride is CCN(CC)C(=O)O.[H-].[Na+].
What is the InChIKey of sodium;diethylcarbamic acid;hydride?
The InChIKey is GBLHKBZKSKECRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO2.Na.H/c1-3-6(4-2)5(7)8;;/h3-4H2,1-2H3,(H,7,8);;/q;+1;-1.
What are the key properties of sodium;diethylcarbamic acid;hydride?
sodium;diethylcarbamic acid;hydride has a molecular weight of 141.15 g/mol, XLogP of -1.88, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;diethylcarbamic acid;hydride is sourced from PubChem (CID 174452447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).