C10H23ClN2Si — CID 173059122
2-chloro-1-N,1-N,1-N',1-N'-tetraethyl-2-silylethene-1,1-diamine (PubChem CID 173059122) has the molecular formula C10H23ClN2Si and a molecular weight of 234.85 g/mol. Its IUPAC name is 2-chloro-1-N,1-N,1-N',1-N'-tetraethyl-2-silylethene-1,1-diamine.
| Compound Name | 2-chloro-1-N,1-N,1-N',1-N'-tetraethyl-2-silylethene-1,1-diamine |
|---|---|
| PubChem CID | 173059122 |
| Molecular Formula | C10H23ClN2Si |
| Molecular Weight | 234.85 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | 2-chloro-1-N,1-N,1-N',1-N'-tetraethyl-2-silylethene-1,1-diamine |
| SMILES | CCN(CC)C(=C([SiH3])Cl)N(CC)CC |
| InChI | InChI=1S/C10H23ClN2Si/c1-5-12(6-2)10(9(11)14)13(7-3)8-4/h5-8H2,1-4,14H3 |
| InChIKey | UAFSMWMYQJNJFS-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.85 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|