C11H27N3Si — CID 123712691
1-N,1-N',2-N-triethyl-1-N,1-N',2-N-trimethyl-2-silylethene-1,1,2-triamine (PubChem CID 123712691) has the molecular formula C11H27N3Si and a molecular weight of 229.44 g/mol. Its IUPAC name is 1-N,1-N',2-N-triethyl-1-N,1-N',2-N-trimethyl-2-silylethene-1,1,2-triamine.
| Compound Name | 1-N,1-N',2-N-triethyl-1-N,1-N',2-N-trimethyl-2-silylethene-1,1,2-triamine |
|---|---|
| PubChem CID | 123712691 |
| Molecular Formula | C11H27N3Si |
| Molecular Weight | 229.44 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | 1-N,1-N',2-N-triethyl-1-N,1-N',2-N-trimethyl-2-silylethene-1,1,2-triamine |
| SMILES | CCN(C)C([SiH3])=C(N(C)CC)N(C)CC |
| InChI | InChI=1S/C11H27N3Si/c1-7-12(4)10(13(5)8-2)11(15)14(6)9-3/h7-9H2,1-6,15H3 |
| InChIKey | KNDAUNKFZNWQDC-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.44 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|