C7H16N2Se — CID 134989232
1,3-diethyl-1,3-dimethylselenourea (PubChem CID 134989232) has the molecular formula C7H16N2Se and a molecular weight of 207.18 g/mol. Its IUPAC name is 1,3-diethyl-1,3-dimethylselenourea.
| Compound Name | 1,3-diethyl-1,3-dimethylselenourea |
|---|---|
| PubChem CID | 134989232 |
| Molecular Formula | C7H16N2Se |
| Molecular Weight | 207.18 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 1,3-diethyl-1,3-dimethylselenourea |
| SMILES | CCN(C)C(=[Se])N(C)CC |
| InChI | InChI=1S/C7H16N2Se/c1-5-8(3)7(10)9(4)6-2/h5-6H2,1-4H3 |
| InChIKey | QMIPQNYZQOZNRG-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.18 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|