About N-ethyl-N'-hydroxy-N-methylethanimidamide;dihydrochloride
N-ethyl-N'-hydroxy-N-methylethanimidamide;dihydrochloride (PubChem CID 172735964) has the molecular formula C5H14Cl2N2O
and a molecular weight of 189.09 g/mol. Its IUPAC name is N-ethyl-N'-hydroxy-N-methylethanimidamide;dihydrochloride.
Molecular Properties
| Compound Name | N-ethyl-N'-hydroxy-N-methylethanimidamide;dihydrochloride |
| PubChem CID | 172735964 |
| Molecular Formula | C5H14Cl2N2O |
| Molecular Weight | 189.09 g/mol |
| Exact Mass | 188.05 |
| IUPAC Name | N-ethyl-N'-hydroxy-N-methylethanimidamide;dihydrochloride |
| SMILES | CCN(C)C(C)=NO.Cl.Cl |
| InChI | InChI=1S/C5H12N2O.2ClH/c1-4-7(3)5(2)6-8;;/h8H,4H2,1-3H3;2*1H |
| InChIKey | ILCIYECOGUQUSQ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.09 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N'-hydroxy-N-methylethanimidamide;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N'-hydroxy-N-methylethanimidamide;dihydrochloride?
The IUPAC name of N-ethyl-N'-hydroxy-N-methylethanimidamide;dihydrochloride (CID 172735964) is N-ethyl-N'-hydroxy-N-methylethanimidamide;dihydrochloride.
What is the SMILES notation for N-ethyl-N'-hydroxy-N-methylethanimidamide;dihydrochloride?
The canonical SMILES for N-ethyl-N'-hydroxy-N-methylethanimidamide;dihydrochloride is CCN(C)C(C)=NO.Cl.Cl.
What is the InChIKey of N-ethyl-N'-hydroxy-N-methylethanimidamide;dihydrochloride?
The InChIKey is ILCIYECOGUQUSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2O.2ClH/c1-4-7(3)5(2)6-8;;/h8H,4H2,1-3H3;2*1H.
What are the key properties of N-ethyl-N'-hydroxy-N-methylethanimidamide;dihydrochloride?
N-ethyl-N'-hydroxy-N-methylethanimidamide;dihydrochloride has a molecular weight of 189.09 g/mol, XLogP of 1.59, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N'-hydroxy-N-methylethanimidamide;dihydrochloride is sourced from PubChem (CID 172735964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).