C6H17N3 — CID 158668223
1-ethyl-1,2-dimethylguanidine;methane (PubChem CID 158668223) has the molecular formula C6H17N3 and a molecular weight of 131.22 g/mol. Its IUPAC name is 1-ethyl-1,2-dimethylguanidine;methane.
| Compound Name | 1-ethyl-1,2-dimethylguanidine;methane |
|---|---|
| PubChem CID | 158668223 |
| Molecular Formula | C6H17N3 |
| Molecular Weight | 131.22 g/mol |
| Exact Mass | 131.14 |
| IUPAC Name | 1-ethyl-1,2-dimethylguanidine;methane |
| SMILES | C.CCN(C)/C(N)=N/C |
| InChI | InChI=1S/C5H13N3.CH4/c1-4-8(3)5(6)7-2;/h4H2,1-3H3,(H2,6,7);1H4 |
| InChIKey | IDPXPACDHBPDIB-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.22 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|