C6H16N4 — CID 141013160
1-(3-aminopropyl)-1,2-dimethylguanidine (PubChem CID 141013160) has the molecular formula C6H16N4 and a molecular weight of 144.22 g/mol. Its IUPAC name is 1-(3-aminopropyl)-1,2-dimethylguanidine.
| Compound Name | 1-(3-aminopropyl)-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 141013160 |
| Molecular Formula | C6H16N4 |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.14 |
| IUPAC Name | 1-(3-aminopropyl)-1,2-dimethylguanidine |
| SMILES | C/N=C(\N)N(C)CCCN |
| InChI | InChI=1S/C6H16N4/c1-9-6(8)10(2)5-3-4-7/h3-5,7H2,1-2H3,(H2,8,9) |
| InChIKey | QHQSZCZNQMJRDX-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|