About N'-methyl-N'-(3-methylbut-2-en-2-yl)propane-1,3-diamine
N'-methyl-N'-(3-methylbut-2-en-2-yl)propane-1,3-diamine (PubChem CID 138727696) has the molecular formula C9H20N2
and a molecular weight of 156.27 g/mol. Its IUPAC name is N'-methyl-N'-(3-methylbut-2-en-2-yl)propane-1,3-diamine.
Analyze N'-methyl-N'-(3-methylbut-2-en-2-yl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methyl-N'-(3-methylbut-2-en-2-yl)propane-1,3-diamine?
The IUPAC name of N'-methyl-N'-(3-methylbut-2-en-2-yl)propane-1,3-diamine (CID 138727696) is N'-methyl-N'-(3-methylbut-2-en-2-yl)propane-1,3-diamine.
What is the SMILES notation for N'-methyl-N'-(3-methylbut-2-en-2-yl)propane-1,3-diamine?
The canonical SMILES for N'-methyl-N'-(3-methylbut-2-en-2-yl)propane-1,3-diamine is CC(C)=C(C)N(C)CCCN.
What is the InChIKey of N'-methyl-N'-(3-methylbut-2-en-2-yl)propane-1,3-diamine?
The InChIKey is HLRDXYRMMZKYBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2/c1-8(2)9(3)11(4)7-5-6-10/h5-7,10H2,1-4H3.
What are the key properties of N'-methyl-N'-(3-methylbut-2-en-2-yl)propane-1,3-diamine?
N'-methyl-N'-(3-methylbut-2-en-2-yl)propane-1,3-diamine has a molecular weight of 156.27 g/mol, XLogP of 1.58, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methyl-N'-(3-methylbut-2-en-2-yl)propane-1,3-diamine is sourced from PubChem (CID 138727696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).