C9H26N4O — CID 161126374
2-amino-1-(dimethylamino)ethanol;N',N'-dimethylpropane-1,3-diamine (PubChem CID 161126374) has the molecular formula C9H26N4O and a molecular weight of 206.33 g/mol. Its IUPAC name is 2-amino-1-(dimethylamino)ethanol;N',N'-dimethylpropane-1,3-diamine.
| Compound Name | 2-amino-1-(dimethylamino)ethanol;N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 161126374 |
| Molecular Formula | C9H26N4O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.21 |
| IUPAC Name | 2-amino-1-(dimethylamino)ethanol;N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)C(O)CN.CN(C)CCCN |
| InChI | InChI=1S/C5H14N2.C4H12N2O/c1-7(2)5-3-4-6;1-6(2)4(7)3-5/h3-6H2,1-2H3;4,7H,3,5H2,1-2H3 |
| InChIKey | ULPMUJWTANUZAY-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 78.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|