C5H13N3O3S — CID 174323416
2-[methyl-(N'-methylcarbamimidoyl)amino]ethanesulfonic acid (PubChem CID 174323416) has the molecular formula C5H13N3O3S and a molecular weight of 195.24 g/mol. Its IUPAC name is 2-[methyl-(N'-methylcarbamimidoyl)amino]ethanesulfonic acid.
| Compound Name | 2-[methyl-(N'-methylcarbamimidoyl)amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 174323416 |
| Molecular Formula | C5H13N3O3S |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | 2-[methyl-(N'-methylcarbamimidoyl)amino]ethanesulfonic acid |
| SMILES | C/N=C(\N)N(C)CCS(=O)(=O)O |
| InChI | InChI=1S/C5H13N3O3S/c1-7-5(6)8(2)3-4-12(9,10)11/h3-4H2,1-2H3,(H2,6,7)(H,9,10,11) |
| InChIKey | RYTBQAYROBOSLH-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|