C7H18N2O6S2 — CID 174760174
2-[3-aminopropyl(2-sulfoethyl)amino]ethanesulfonic acid (PubChem CID 174760174) has the molecular formula C7H18N2O6S2 and a molecular weight of 290.36 g/mol. Its IUPAC name is 2-[3-aminopropyl(2-sulfoethyl)amino]ethanesulfonic acid.
| Compound Name | 2-[3-aminopropyl(2-sulfoethyl)amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 174760174 |
| Molecular Formula | C7H18N2O6S2 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 2-[3-aminopropyl(2-sulfoethyl)amino]ethanesulfonic acid |
| SMILES | NCCCN(CCS(=O)(=O)O)CCS(=O)(=O)O |
| InChI | InChI=1S/C7H18N2O6S2/c8-2-1-3-9(4-6-16(10,11)12)5-7-17(13,14)15/h1-8H2,(H,10,11,12)(H,13,14,15) |
| InChIKey | PGIFPKCAEFHLBP-UHFFFAOYSA-N |
| XLogP | -1.59 |
| TPSA | 138.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|