C9H20N2O7S2 — CID 58598637
3-[methyl-[methyl(3-sulfopropyl)carbamoyl]amino]propane-1-sulfonic acid (PubChem CID 58598637) has the molecular formula C9H20N2O7S2 and a molecular weight of 332.40 g/mol. Its IUPAC name is 3-[methyl-[methyl(3-sulfopropyl)carbamoyl]amino]propane-1-sulfonic acid.
| Compound Name | 3-[methyl-[methyl(3-sulfopropyl)carbamoyl]amino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 58598637 |
| Molecular Formula | C9H20N2O7S2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 3-[methyl-[methyl(3-sulfopropyl)carbamoyl]amino]propane-1-sulfonic acid |
| SMILES | CN(CCCS(=O)(=O)O)C(=O)N(C)CCCS(=O)(=O)O |
| InChI | InChI=1S/C9H20N2O7S2/c1-10(5-3-7-19(13,14)15)9(12)11(2)6-4-8-20(16,17)18/h3-8H2,1-2H3,(H,13,14,15)(H,16,17,18) |
| InChIKey | CAQPXONONAYZGO-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 132.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|