C5H15NO9P2S — CID 88769209
3-[diphosphonomethyl(methyl)amino]propane-1-sulfonic acid (PubChem CID 88769209) has the molecular formula C5H15NO9P2S and a molecular weight of 327.19 g/mol. Its IUPAC name is 3-[diphosphonomethyl(methyl)amino]propane-1-sulfonic acid.
| Compound Name | 3-[diphosphonomethyl(methyl)amino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 88769209 |
| Molecular Formula | C5H15NO9P2S |
| Molecular Weight | 327.19 g/mol |
| Exact Mass | 326.99 |
| IUPAC Name | 3-[diphosphonomethyl(methyl)amino]propane-1-sulfonic acid |
| SMILES | CN(CCCS(=O)(=O)O)C(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C5H15NO9P2S/c1-6(3-2-4-18(13,14)15)5(16(7,8)9)17(10,11)12/h5H,2-4H2,1H3,(H2,7,8,9)(H2,10,11,12)(H,13,14,15) |
| InChIKey | BSRMCRMWDPLDRS-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 172.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.19 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|