C7H17NO5S — CID 57223750
3-[bis(1-hydroxyethyl)amino]propane-1-sulfonic acid (PubChem CID 57223750) has the molecular formula C7H17NO5S and a molecular weight of 227.28 g/mol. Its IUPAC name is 3-[bis(1-hydroxyethyl)amino]propane-1-sulfonic acid.
| Compound Name | 3-[bis(1-hydroxyethyl)amino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 57223750 |
| Molecular Formula | C7H17NO5S |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 3-[bis(1-hydroxyethyl)amino]propane-1-sulfonic acid |
| SMILES | CC(O)N(CCCS(=O)(=O)O)C(C)O |
| InChI | InChI=1S/C7H17NO5S/c1-6(9)8(7(2)10)4-3-5-14(11,12)13/h6-7,9-10H,3-5H2,1-2H3,(H,11,12,13) |
| InChIKey | YLRSGHCNKNKJTC-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|