1-[butyl(1-hydroxyethyl)amino]ethanol;formic acid

C9H21NO4 — CID 87203656

IUPAC1-[butyl(1-hydroxyethyl)amino]ethanol;formic acid
SMILESCCCCN(C(C)O)C(C)O.O=CO
InChIInChI=1S/C8H19NO2.CH2O2/c1-4-5-6-9(7(2)10)8(3)11;2-1-3/h7-8,10-11H,4-6H2,1-3H3;1H,(H,2,3)
InChIKeyLISFITKADZJXHS-UHFFFAOYSA-N
MW207.27 g/mol
LogP0.47
Rot. Bonds5

About 1-[butyl(1-hydroxyethyl)amino]ethanol;formic acid

1-[butyl(1-hydroxyethyl)amino]ethanol;formic acid (PubChem CID 87203656) has the molecular formula C9H21NO4 and a molecular weight of 207.27 g/mol. Its IUPAC name is 1-[butyl(1-hydroxyethyl)amino]ethanol;formic acid.

Molecular Properties

Compound Name1-[butyl(1-hydroxyethyl)amino]ethanol;formic acid
PubChem CID87203656
Molecular FormulaC9H21NO4
Molecular Weight207.27 g/mol
Exact Mass207.15
IUPAC Name1-[butyl(1-hydroxyethyl)amino]ethanol;formic acid
SMILESCCCCN(C(C)O)C(C)O.O=CO
InChIInChI=1S/C8H19NO2.CH2O2/c1-4-5-6-9(7(2)10)8(3)11;2-1-3/h7-8,10-11H,4-6H2,1-3H3;1H,(H,2,3)
InChIKeyLISFITKADZJXHS-UHFFFAOYSA-N
XLogP0.47
TPSA81.00 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500207.27
LogP ≤ 50.47
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze 1-[butyl(1-hydroxyethyl)amino]ethanol;formic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-[butyl(1-hydroxyethyl)amino]ethanol;formic acid?
The IUPAC name of 1-[butyl(1-hydroxyethyl)amino]ethanol;formic acid (CID 87203656) is 1-[butyl(1-hydroxyethyl)amino]ethanol;formic acid.
What is the SMILES notation for 1-[butyl(1-hydroxyethyl)amino]ethanol;formic acid?
The canonical SMILES for 1-[butyl(1-hydroxyethyl)amino]ethanol;formic acid is CCCCN(C(C)O)C(C)O.O=CO.
What is the InChIKey of 1-[butyl(1-hydroxyethyl)amino]ethanol;formic acid?
The InChIKey is LISFITKADZJXHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19NO2.CH2O2/c1-4-5-6-9(7(2)10)8(3)11;2-1-3/h7-8,10-11H,4-6H2,1-3H3;1H,(H,2,3).
What are the key properties of 1-[butyl(1-hydroxyethyl)amino]ethanol;formic acid?
1-[butyl(1-hydroxyethyl)amino]ethanol;formic acid has a molecular weight of 207.27 g/mol, XLogP of 0.47, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[butyl(1-hydroxyethyl)amino]ethanol;formic acid is sourced from PubChem (CID 87203656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).