C9H21NO9S2 — CID 54366131
3-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-(2-sulfoethyl)amino]propane-1-sulfonic acid (PubChem CID 54366131) has the molecular formula C9H21NO9S2 and a molecular weight of 351.40 g/mol. Its IUPAC name is 3-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-(2-sulfoethyl)amino]propane-1-sulfonic acid.
| Compound Name | 3-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-(2-sulfoethyl)amino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 54366131 |
| Molecular Formula | C9H21NO9S2 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 3-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-(2-sulfoethyl)amino]propane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCN(CCS(=O)(=O)O)C(CO)(CO)CO |
| InChI | InChI=1S/C9H21NO9S2/c11-6-9(7-12,8-13)10(3-5-21(17,18)19)2-1-4-20(14,15)16/h11-13H,1-8H2,(H,14,15,16)(H,17,18,19) |
| InChIKey | UPXHSVCVADSREI-UHFFFAOYSA-N |
| XLogP | -2.83 |
| TPSA | 172.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | -2.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|