C9H20NO6S- — CID 169065808
3-[[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-(hydroxymethyl)amino]propane-1-sulfonate (PubChem CID 169065808) has the molecular formula C9H20NO6S- and a molecular weight of 270.33 g/mol. Its IUPAC name is 3-[[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-(hydroxymethyl)amino]propane-1-sulfonate.
| Compound Name | 3-[[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-(hydroxymethyl)amino]propane-1-sulfonate |
|---|---|
| PubChem CID | 169065808 |
| Molecular Formula | C9H20NO6S- |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 3-[[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-(hydroxymethyl)amino]propane-1-sulfonate |
| SMILES | CCC(CO)(CO)N(CO)CCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C9H21NO6S/c1-2-9(6-11,7-12)10(8-13)4-3-5-17(14,15)16/h11-13H,2-8H2,1H3,(H,14,15,16)/p-1 |
| InChIKey | SCENJPCSRINKMI-UHFFFAOYSA-M |
| XLogP | -1.69 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|