C10H22NO8S- — CID 169065806
2,3-dihydroxy-3-[2-hydroxyethyl-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]amino]propane-1-sulfonate (PubChem CID 169065806) has the molecular formula C10H22NO8S- and a molecular weight of 316.35 g/mol. Its IUPAC name is 2,3-dihydroxy-3-[2-hydroxyethyl-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]amino]propane-1-sulfonate.
| Compound Name | 2,3-dihydroxy-3-[2-hydroxyethyl-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]amino]propane-1-sulfonate |
|---|---|
| PubChem CID | 169065806 |
| Molecular Formula | C10H22NO8S- |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 2,3-dihydroxy-3-[2-hydroxyethyl-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]amino]propane-1-sulfonate |
| SMILES | CCC(CO)(CO)N(CCO)C(O)C(O)CS(=O)(=O)[O-] |
| InChI | InChI=1S/C10H23NO8S/c1-2-10(6-13,7-14)11(3-4-12)9(16)8(15)5-20(17,18)19/h8-9,12-16H,2-7H2,1H3,(H,17,18,19)/p-1 |
| InChIKey | GTVVYCXZKBOPFU-UHFFFAOYSA-M |
| XLogP | -3.36 |
| TPSA | 161.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | -3.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|