C9H20NO7S- — CID 169065701
1,2-dihydroxy-3-[1-hydroxybutan-2-yl(2-hydroxyethyl)amino]propane-1-sulfonate (PubChem CID 169065701) has the molecular formula C9H20NO7S- and a molecular weight of 286.33 g/mol. Its IUPAC name is 1,2-dihydroxy-3-[1-hydroxybutan-2-yl(2-hydroxyethyl)amino]propane-1-sulfonate.
| Compound Name | 1,2-dihydroxy-3-[1-hydroxybutan-2-yl(2-hydroxyethyl)amino]propane-1-sulfonate |
|---|---|
| PubChem CID | 169065701 |
| Molecular Formula | C9H20NO7S- |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 1,2-dihydroxy-3-[1-hydroxybutan-2-yl(2-hydroxyethyl)amino]propane-1-sulfonate |
| SMILES | CCC(CO)N(CCO)CC(O)C(O)S(=O)(=O)[O-] |
| InChI | InChI=1S/C9H21NO7S/c1-2-7(6-12)10(3-4-11)5-8(13)9(14)18(15,16)17/h7-9,11-14H,2-6H2,1H3,(H,15,16,17)/p-1 |
| InChIKey | QIJMCIFXLLJQOG-UHFFFAOYSA-M |
| XLogP | -2.72 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | -2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|