C8H19NO5S — CID 170223353
2-[1-hydroxybutan-2-yl(2-hydroxyethyl)amino]ethanesulfonic acid (PubChem CID 170223353) has the molecular formula C8H19NO5S and a molecular weight of 241.31 g/mol. Its IUPAC name is 2-[1-hydroxybutan-2-yl(2-hydroxyethyl)amino]ethanesulfonic acid.
| Compound Name | 2-[1-hydroxybutan-2-yl(2-hydroxyethyl)amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 170223353 |
| Molecular Formula | C8H19NO5S |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 2-[1-hydroxybutan-2-yl(2-hydroxyethyl)amino]ethanesulfonic acid |
| SMILES | CCC(CO)N(CCO)CCS(=O)(=O)O |
| InChI | InChI=1S/C8H19NO5S/c1-2-8(7-11)9(3-5-10)4-6-15(12,13)14/h8,10-11H,2-7H2,1H3,(H,12,13,14) |
| InChIKey | JHBSAXPNWJKVSV-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|