C8H21NO7S — CID 159321918
2-[bis(2-hydroxyethyl)amino]propan-1-ol;methyl hydrogen sulfate (PubChem CID 159321918) has the molecular formula C8H21NO7S and a molecular weight of 275.32 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethyl)amino]propan-1-ol;methyl hydrogen sulfate.
| Compound Name | 2-[bis(2-hydroxyethyl)amino]propan-1-ol;methyl hydrogen sulfate |
|---|---|
| PubChem CID | 159321918 |
| Molecular Formula | C8H21NO7S |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]propan-1-ol;methyl hydrogen sulfate |
| SMILES | CC(CO)N(CCO)CCO.COS(=O)(=O)O |
| InChI | InChI=1S/C7H17NO3.CH4O4S/c1-7(6-11)8(2-4-9)3-5-10;1-5-6(2,3)4/h7,9-11H,2-6H2,1H3;1H3,(H,2,3,4) |
| InChIKey | LDWJKFVBMNCBRI-UHFFFAOYSA-N |
| XLogP | -1.91 |
| TPSA | 127.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|