About azane;2-[bis(2-hydroxyethyl)amino]tetradecan-1-ol;sulfuric acid
azane;2-[bis(2-hydroxyethyl)amino]tetradecan-1-ol;sulfuric acid (PubChem CID 174235324) has the molecular formula C18H47N3O7S
and a molecular weight of 449.66 g/mol. Its IUPAC name is azane;2-[bis(2-hydroxyethyl)amino]tetradecan-1-ol;sulfuric acid.
Molecular Properties
| Compound Name | azane;2-[bis(2-hydroxyethyl)amino]tetradecan-1-ol;sulfuric acid |
| PubChem CID | 174235324 |
| Molecular Formula | C18H47N3O7S |
| Molecular Weight | 449.66 g/mol |
| Exact Mass | 449.31 |
| IUPAC Name | azane;2-[bis(2-hydroxyethyl)amino]tetradecan-1-ol;sulfuric acid |
| SMILES | CCCCCCCCCCCCC(CO)N(CCO)CCO.N.N.O=S(=O)(O)O |
| InChI | InChI=1S/C18H39NO3.2H3N.H2O4S/c1-2-3-4-5-6-7-8-9-10-11-12-18(17-22)19(13-15-20)14-16-21;;;1-5(2,3)4/h18,20-22H,2-17H2,1H3;2*1H3;(H2,1,2,3,4) |
| InChIKey | WWMARWPLKJBGJZ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 208.53 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 449.66 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze azane;2-[bis(2-hydroxyethyl)amino]tetradecan-1-ol;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-[bis(2-hydroxyethyl)amino]tetradecan-1-ol;sulfuric acid?
The IUPAC name of azane;2-[bis(2-hydroxyethyl)amino]tetradecan-1-ol;sulfuric acid (CID 174235324) is azane;2-[bis(2-hydroxyethyl)amino]tetradecan-1-ol;sulfuric acid.
What is the SMILES notation for azane;2-[bis(2-hydroxyethyl)amino]tetradecan-1-ol;sulfuric acid?
The canonical SMILES for azane;2-[bis(2-hydroxyethyl)amino]tetradecan-1-ol;sulfuric acid is CCCCCCCCCCCCC(CO)N(CCO)CCO.N.N.O=S(=O)(O)O.
What is the InChIKey of azane;2-[bis(2-hydroxyethyl)amino]tetradecan-1-ol;sulfuric acid?
The InChIKey is WWMARWPLKJBGJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H39NO3.2H3N.H2O4S/c1-2-3-4-5-6-7-8-9-10-11-12-18(17-22)19(13-15-20)14-16-21;;;1-5(2,3)4/h18,20-22H,2-17H2,1H3;2*1H3;(H2,1,2,3,4).
What are the key properties of azane;2-[bis(2-hydroxyethyl)amino]tetradecan-1-ol;sulfuric acid?
azane;2-[bis(2-hydroxyethyl)amino]tetradecan-1-ol;sulfuric acid has a molecular weight of 449.66 g/mol, XLogP of 2.62, 17 rotatable bonds, 7 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-[bis(2-hydroxyethyl)amino]tetradecan-1-ol;sulfuric acid is sourced from PubChem (CID 174235324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).