C7H17NO7S — CID 141277036
2-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-hydroxyamino]propane-1-sulfonic acid (PubChem CID 141277036) has the molecular formula C7H17NO7S and a molecular weight of 259.28 g/mol. Its IUPAC name is 2-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-hydroxyamino]propane-1-sulfonic acid.
| Compound Name | 2-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-hydroxyamino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 141277036 |
| Molecular Formula | C7H17NO7S |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 2-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-hydroxyamino]propane-1-sulfonic acid |
| SMILES | CC(CS(=O)(=O)O)N(O)C(CO)(CO)CO |
| InChI | InChI=1S/C7H17NO7S/c1-6(2-16(13,14)15)8(12)7(3-9,4-10)5-11/h6,9-12H,2-5H2,1H3,(H,13,14,15) |
| InChIKey | CNKULRGVZYBYJL-UHFFFAOYSA-N |
| XLogP | -2.33 |
| TPSA | 138.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|