C9H19NO4S — CID 174191866
2-[cyclohexyl(hydroxy)amino]propane-1-sulfonic acid (PubChem CID 174191866) has the molecular formula C9H19NO4S and a molecular weight of 237.32 g/mol. Its IUPAC name is 2-[cyclohexyl(hydroxy)amino]propane-1-sulfonic acid.
| Compound Name | 2-[cyclohexyl(hydroxy)amino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 174191866 |
| Molecular Formula | C9H19NO4S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 2-[cyclohexyl(hydroxy)amino]propane-1-sulfonic acid |
| SMILES | CC(CS(=O)(=O)O)N(O)C1CCCCC1 |
| InChI | InChI=1S/C9H19NO4S/c1-8(7-15(12,13)14)10(11)9-5-3-2-4-6-9/h8-9,11H,2-7H2,1H3,(H,12,13,14) |
| InChIKey | BBENBFQUCLMMGT-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|