C10H22N2O3S — CID 154318738
(2R,3S)-2,3-diamino-4-cyclohexylbutane-1-sulfonic acid (PubChem CID 154318738) has the molecular formula C10H22N2O3S and a molecular weight of 250.36 g/mol. Its IUPAC name is (2R,3S)-2,3-diamino-4-cyclohexylbutane-1-sulfonic acid.
| Compound Name | (2R,3S)-2,3-diamino-4-cyclohexylbutane-1-sulfonic acid |
|---|---|
| PubChem CID | 154318738 |
| Molecular Formula | C10H22N2O3S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | (2R,3S)-2,3-diamino-4-cyclohexylbutane-1-sulfonic acid |
| SMILES | N[C@@H](CC1CCCCC1)[C@@H](N)CS(=O)(=O)O |
| InChI | InChI=1S/C10H22N2O3S/c11-9(10(12)7-16(13,14)15)6-8-4-2-1-3-5-8/h8-10H,1-7,11-12H2,(H,13,14,15)/t9-,10-/m0/s1 |
| InChIKey | SQYZNWGCKCZHRG-UWVGGRQHSA-N |
| XLogP | 0.50 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|