About 2-(dichloroamino)-2-methylpropane-1-sulfonic acid;2-(dichloroamino)propane-1-sulfonic acid
2-(dichloroamino)-2-methylpropane-1-sulfonic acid;2-(dichloroamino)propane-1-sulfonic acid (PubChem CID 87370884) has the molecular formula C7H16Cl4N2O6S2
and a molecular weight of 430.16 g/mol. Its IUPAC name is 2-(dichloroamino)-2-methylpropane-1-sulfonic acid;2-(dichloroamino)propane-1-sulfonic acid.
Molecular Properties
| Compound Name | 2-(dichloroamino)-2-methylpropane-1-sulfonic acid;2-(dichloroamino)propane-1-sulfonic acid |
| PubChem CID | 87370884 |
| Molecular Formula | C7H16Cl4N2O6S2 |
| Molecular Weight | 430.16 g/mol |
| Exact Mass | 427.92 |
| IUPAC Name | 2-(dichloroamino)-2-methylpropane-1-sulfonic acid;2-(dichloroamino)propane-1-sulfonic acid |
| SMILES | CC(C)(CS(=O)(=O)O)N(Cl)Cl.CC(CS(=O)(=O)O)N(Cl)Cl |
| InChI | InChI=1S/C4H9Cl2NO3S.C3H7Cl2NO3S/c1-4(2,7(5)6)3-11(8,9)10;1-3(6(4)5)2-10(7,8)9/h3H2,1-2H3,(H,8,9,10);3H,2H2,1H3,(H,7,8,9) |
| InChIKey | ISBBHZULUXLQIY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.16 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(dichloroamino)-2-methylpropane-1-sulfonic acid;2-(dichloroamino)propane-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dichloroamino)-2-methylpropane-1-sulfonic acid;2-(dichloroamino)propane-1-sulfonic acid?
The IUPAC name of 2-(dichloroamino)-2-methylpropane-1-sulfonic acid;2-(dichloroamino)propane-1-sulfonic acid (CID 87370884) is 2-(dichloroamino)-2-methylpropane-1-sulfonic acid;2-(dichloroamino)propane-1-sulfonic acid.
What is the SMILES notation for 2-(dichloroamino)-2-methylpropane-1-sulfonic acid;2-(dichloroamino)propane-1-sulfonic acid?
The canonical SMILES for 2-(dichloroamino)-2-methylpropane-1-sulfonic acid;2-(dichloroamino)propane-1-sulfonic acid is CC(C)(CS(=O)(=O)O)N(Cl)Cl.CC(CS(=O)(=O)O)N(Cl)Cl.
What is the InChIKey of 2-(dichloroamino)-2-methylpropane-1-sulfonic acid;2-(dichloroamino)propane-1-sulfonic acid?
The InChIKey is ISBBHZULUXLQIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9Cl2NO3S.C3H7Cl2NO3S/c1-4(2,7(5)6)3-11(8,9)10;1-3(6(4)5)2-10(7,8)9/h3H2,1-2H3,(H,8,9,10);3H,2H2,1H3,(H,7,8,9).
What are the key properties of 2-(dichloroamino)-2-methylpropane-1-sulfonic acid;2-(dichloroamino)propane-1-sulfonic acid?
2-(dichloroamino)-2-methylpropane-1-sulfonic acid;2-(dichloroamino)propane-1-sulfonic acid has a molecular weight of 430.16 g/mol, XLogP of 2.13, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dichloroamino)-2-methylpropane-1-sulfonic acid;2-(dichloroamino)propane-1-sulfonic acid is sourced from PubChem (CID 87370884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).