C7H19NO5S — CID 87716650
2-amino-2-methylpropan-1-ol;2-hydroxypropane-1-sulfonic acid (PubChem CID 87716650) has the molecular formula C7H19NO5S and a molecular weight of 229.30 g/mol. Its IUPAC name is 2-amino-2-methylpropan-1-ol;2-hydroxypropane-1-sulfonic acid.
| Compound Name | 2-amino-2-methylpropan-1-ol;2-hydroxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 87716650 |
| Molecular Formula | C7H19NO5S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 2-amino-2-methylpropan-1-ol;2-hydroxypropane-1-sulfonic acid |
| SMILES | CC(C)(N)CO.CC(O)CS(=O)(=O)O |
| InChI | InChI=1S/C4H11NO.C3H8O4S/c1-4(2,5)3-6;1-3(4)2-8(5,6)7/h6H,3,5H2,1-2H3;3-4H,2H2,1H3,(H,5,6,7) |
| InChIKey | FSWKQKZHWFLRLG-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|