C4H9BrClNO3S — CID 44814599
2-[bromo(chloro)amino]-2-methylpropane-1-sulfonic acid (PubChem CID 44814599) has the molecular formula C4H9BrClNO3S and a molecular weight of 266.54 g/mol. Its IUPAC name is 2-[bromo(chloro)amino]-2-methylpropane-1-sulfonic acid.
| Compound Name | 2-[bromo(chloro)amino]-2-methylpropane-1-sulfonic acid |
|---|---|
| PubChem CID | 44814599 |
| Molecular Formula | C4H9BrClNO3S |
| Molecular Weight | 266.54 g/mol |
| Exact Mass | 264.92 |
| IUPAC Name | 2-[bromo(chloro)amino]-2-methylpropane-1-sulfonic acid |
| SMILES | CC(C)(CS(=O)(=O)O)N(Cl)Br |
| InChI | InChI=1S/C4H9BrClNO3S/c1-4(2,7(5)6)3-11(8,9)10/h3H2,1-2H3,(H,8,9,10) |
| InChIKey | DYMAYYQELWBJQD-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.54 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|