C6H14ClNO3S — CID 25054883
3-[chloro(methyl)amino]-3-methylbutane-1-sulfonic acid (PubChem CID 25054883) has the molecular formula C6H14ClNO3S and a molecular weight of 215.70 g/mol. Its IUPAC name is 3-[chloro(methyl)amino]-3-methylbutane-1-sulfonic acid.
| Compound Name | 3-[chloro(methyl)amino]-3-methylbutane-1-sulfonic acid |
|---|---|
| PubChem CID | 25054883 |
| Molecular Formula | C6H14ClNO3S |
| Molecular Weight | 215.70 g/mol |
| Exact Mass | 215.04 |
| IUPAC Name | 3-[chloro(methyl)amino]-3-methylbutane-1-sulfonic acid |
| SMILES | CN(Cl)C(C)(C)CCS(=O)(=O)O |
| InChI | InChI=1S/C6H14ClNO3S/c1-6(2,8(3)7)4-5-12(9,10)11/h4-5H2,1-3H3,(H,9,10,11) |
| InChIKey | NGKAOXBGOOYDRX-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.70 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|