C13H27Cl2NO5S2 — CID 54584529
8-[3-(dichloroamino)-3-methylbutyl]sulfonyloctane-1-sulfonic acid (PubChem CID 54584529) has the molecular formula C13H27Cl2NO5S2 and a molecular weight of 412.40 g/mol. Its IUPAC name is 8-[3-(dichloroamino)-3-methylbutyl]sulfonyloctane-1-sulfonic acid.
| Compound Name | 8-[3-(dichloroamino)-3-methylbutyl]sulfonyloctane-1-sulfonic acid |
|---|---|
| PubChem CID | 54584529 |
| Molecular Formula | C13H27Cl2NO5S2 |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | 8-[3-(dichloroamino)-3-methylbutyl]sulfonyloctane-1-sulfonic acid |
| SMILES | CC(C)(CCS(=O)(=O)CCCCCCCCS(=O)(=O)O)N(Cl)Cl |
| InChI | InChI=1S/C13H27Cl2NO5S2/c1-13(2,16(14)15)9-12-22(17,18)10-7-5-3-4-6-8-11-23(19,20)21/h3-12H2,1-2H3,(H,19,20,21) |
| InChIKey | QLGDARIZDKLYID-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|