C9H23NO3S — CID 175325645
azane;3,3-diethylpentane-1-sulfonic acid (PubChem CID 175325645) has the molecular formula C9H23NO3S and a molecular weight of 225.35 g/mol. Its IUPAC name is azane;3,3-diethylpentane-1-sulfonic acid.
| Compound Name | azane;3,3-diethylpentane-1-sulfonic acid |
|---|---|
| PubChem CID | 175325645 |
| Molecular Formula | C9H23NO3S |
| Molecular Weight | 225.35 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | azane;3,3-diethylpentane-1-sulfonic acid |
| SMILES | CCC(CC)(CC)CCS(=O)(=O)O.N |
| InChI | InChI=1S/C9H20O3S.H3N/c1-4-9(5-2,6-3)7-8-13(10,11)12;/h4-8H2,1-3H3,(H,10,11,12);1H3 |
| InChIKey | SPXUNLWNJUHPRQ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 89.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.35 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|