C8H16Cl2O2S — CID 79447234
3,3-bis(chloromethyl)-1-methylsulfonylpentane (PubChem CID 79447234) has the molecular formula C8H16Cl2O2S and a molecular weight of 247.19 g/mol. Its IUPAC name is 3,3-bis(chloromethyl)-1-methylsulfonylpentane.
| Compound Name | 3,3-bis(chloromethyl)-1-methylsulfonylpentane |
|---|---|
| PubChem CID | 79447234 |
| Molecular Formula | C8H16Cl2O2S |
| Molecular Weight | 247.19 g/mol |
| Exact Mass | 246.02 |
| IUPAC Name | 3,3-bis(chloromethyl)-1-methylsulfonylpentane |
| SMILES | CCC(CCl)(CCl)CCS(C)(=O)=O |
| InChI | InChI=1S/C8H16Cl2O2S/c1-3-8(6-9,7-10)4-5-13(2,11)12/h3-7H2,1-2H3 |
| InChIKey | UABPGKSGPBMGMZ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.19 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|