C10H23NO6S — CID 167409196
[2-hydroxyethyl-[1-hydroxy-2-(hydroxymethyl)-4-methylpentan-2-yl]amino]methanesulfonic acid (PubChem CID 167409196) has the molecular formula C10H23NO6S and a molecular weight of 285.36 g/mol. Its IUPAC name is [2-hydroxyethyl-[1-hydroxy-2-(hydroxymethyl)-4-methylpentan-2-yl]amino]methanesulfonic acid.
| Compound Name | [2-hydroxyethyl-[1-hydroxy-2-(hydroxymethyl)-4-methylpentan-2-yl]amino]methanesulfonic acid |
|---|---|
| PubChem CID | 167409196 |
| Molecular Formula | C10H23NO6S |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | [2-hydroxyethyl-[1-hydroxy-2-(hydroxymethyl)-4-methylpentan-2-yl]amino]methanesulfonic acid |
| SMILES | CC(C)CC(CO)(CO)N(CCO)CS(=O)(=O)O |
| InChI | InChI=1S/C10H23NO6S/c1-9(2)5-10(6-13,7-14)11(3-4-12)8-18(15,16)17/h9,12-14H,3-8H2,1-2H3,(H,15,16,17) |
| InChIKey | QMXGHVHFUMEJTE-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|