C13H29NO7S — CID 170174283
1,3-dihydroxy-3-[2-hydroxyethyl-[3-(hydroxymethyl)-5-methylhexan-3-yl]amino]propane-1-sulfonic acid (PubChem CID 170174283) has the molecular formula C13H29NO7S and a molecular weight of 343.44 g/mol. Its IUPAC name is 1,3-dihydroxy-3-[2-hydroxyethyl-[3-(hydroxymethyl)-5-methylhexan-3-yl]amino]propane-1-sulfonic acid.
| Compound Name | 1,3-dihydroxy-3-[2-hydroxyethyl-[3-(hydroxymethyl)-5-methylhexan-3-yl]amino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 170174283 |
| Molecular Formula | C13H29NO7S |
| Molecular Weight | 343.44 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | 1,3-dihydroxy-3-[2-hydroxyethyl-[3-(hydroxymethyl)-5-methylhexan-3-yl]amino]propane-1-sulfonic acid |
| SMILES | CCC(CO)(CC(C)C)N(CCO)C(O)CC(O)S(=O)(=O)O |
| InChI | InChI=1S/C13H29NO7S/c1-4-13(9-16,8-10(2)3)14(5-6-15)11(17)7-12(18)22(19,20)21/h10-12,15-18H,4-9H2,1-3H3,(H,19,20,21) |
| InChIKey | OZOIIERCJVUOEL-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 138.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.44 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|