C11H25NO7S — CID 167409307
1,3-dihydroxy-3-[2-hydroxyethyl-(1-hydroxy-4-methylpentan-2-yl)amino]propane-1-sulfonic acid (PubChem CID 167409307) has the molecular formula C11H25NO7S and a molecular weight of 315.39 g/mol. Its IUPAC name is 1,3-dihydroxy-3-[2-hydroxyethyl-(1-hydroxy-4-methylpentan-2-yl)amino]propane-1-sulfonic acid.
| Compound Name | 1,3-dihydroxy-3-[2-hydroxyethyl-(1-hydroxy-4-methylpentan-2-yl)amino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 167409307 |
| Molecular Formula | C11H25NO7S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 1,3-dihydroxy-3-[2-hydroxyethyl-(1-hydroxy-4-methylpentan-2-yl)amino]propane-1-sulfonic acid |
| SMILES | CC(C)CC(CO)N(CCO)C(O)CC(O)S(=O)(=O)O |
| InChI | InChI=1S/C11H25NO7S/c1-8(2)5-9(7-14)12(3-4-13)10(15)6-11(16)20(17,18)19/h8-11,13-16H,3-7H2,1-2H3,(H,17,18,19) |
| InChIKey | LBEGQUJGKXSZDI-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 138.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|